On Target NA_INFB 0.5555556/CHEMBL369125
For the given ligand Lisinopril, we have found in our database that, being scored 0.5555556, the most similar ligand is CHEMBL369125. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL369125 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | COC(=O)[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00030000 01003000 00100100 04010500 00180080 00000010 00000000 20000008 00000000 00020080 00200000 4001b000 0e00803a 03802001 80180000 00080008 10a20000 00000000 00c02010 00000201 00000000 30040e30 03000081 02100018 00001001 00000000 00000200 10000000 08000200 00040001 00024000 00802a00 |