On Target PLP_SARS 0.34033614/CHEMBL213054
For the given ligand Ledipasvir, we have found in our database that, being scored 0.34033614, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Ledipasvir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N2CC1(CC1)C[C@H]2c%10nc(c9ccc8c7ccc(c6ccc5[nH]c([C@@H]4[C@H]3CC[C@H](C3)N4C(=O)[C@@H](NC(=O)OC)C(C)C)nc5c6)cc7C(F)(F)c8c9)c[nH]%10)C(C)C | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0000a00a 01003801 00100d00 94050e10 00040061 1011c01a 01400400 21082049 00800300 000808d0 09218004 7081ba02 0e008082 0970a000 20020040 821e010c 00028000 06083026 04202018 50080a1b 44300008 38070e30 31806011 02500038 00940001 a0080082 00000248 d00010e1 0a414284 01e60803 e01248a0 200066a0 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |