On Target NS3_HCV1A 0.37804878/CHEMBL3645728
For the given ligand Voxilaprevir, we have found in our database that, being scored 0.37804878, the most similar ligand is CHEMBL3645728. Check out the elaboration below.
| Voxilaprevir (Given Ligand) | CHEMBL3645728 (Similar Ligand) |
|---|---|
| CC[C@@H]5[C@@H]4CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@@H]1CCCCC(F)(F)c3nc2ccc(OC)cc2nc3O4)[C@@H]5C(=O)N[C@]7(C(=O)NS(=O)(=O)C6(C)CC6)C[C@H]7C(F)F | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1[nH]c(C)c(C)c1C(C)=O)C(C)(C)C)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b11710 801c1de0 86018114 070aa803 a0609208 10c10a00 004888f0 0424a404 4085b040 0e00c816 09c42903 f1fe1141 021ea40c 1aaa0020 260a8104 00e02c18 00064201 50120040 bc148e30 33a00083 72168438 02042403 40001082 08808260 902000ad 0c000306 06864803 a0064000 25212a70 | 0001808a 0d80b800 00100100 55300e10 04000020 00108012 100a2080 2200340d 10400100 00598898 00292404 40013000 8600c89a 0934a011 80420480 080c810c 02004000 02000026 40312400 00004201 84020000 bc0786f0 20806003 3254003c 02142000 40000000 08004010 9000100c 08000104 80060083 a4024200 01016270 |