On Target NA_INFB 0.30536914/CHEMBL362993
For the given ligand Voxilaprevir, we have found in our database that, being scored 0.30536914, the most similar ligand is CHEMBL362993. Check out the elaboration below.
| Voxilaprevir (Given Ligand) | CHEMBL362993 (Similar Ligand) |
|---|---|
| CC[C@@H]5[C@@H]4CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@@H]1CCCCC(F)(F)c3nc2ccc(OC)cc2nc3O4)[C@@H]5C(=O)N[C@]7(C(=O)NS(=O)(=O)C6(C)CC6)C[C@H]7C(F)F | CC(=O)N[C@@H](CC(C)C)[C@@H]1N[C@@H](C(=O)O)C[C@H]1c1cc[nH]n1 |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b11710 801c1de0 86018114 070aa803 a0609208 10c10a00 004888f0 0424a404 4085b040 0e00c816 09c42903 f1fe1141 021ea40c 1aaa0020 260a8104 00e02c18 00064201 50120040 bc148e30 33a00083 72168438 02042403 40001082 08808260 902000ad 0c000306 06864803 a0064000 25212a70 | 04010000 01003208 20100102 04000600 01080080 00000012 00000020 20000208 00000880 000c0080 00308000 400130c0 1e00801a 01a02001 81180000 000c200c 90000000 0e000000 00402000 00220241 00100000 32240e30 07800801 03100018 00002000 00000000 00120000 10000180 0c000006 0006c00b 00024000 00c02e20 |