On Target PLP_SARS 0.3108108/CHEMBL213054
For the given ligand Voxilaprevir, we have found in our database that, being scored 0.3108108, the most similar ligand is CHEMBL213054. Check out the elaboration below.
| Voxilaprevir (Given Ligand) | CHEMBL213054 (Similar Ligand) |
|---|---|
| CC[C@@H]5[C@@H]4CN(C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@@H]1CCCCC(F)(F)c3nc2ccc(OC)cc2nc3O4)[C@@H]5C(=O)N[C@]7(C(=O)NS(=O)(=O)C6(C)CC6)C[C@H]7C(F)F | CC(OC(C)(C)C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 0405208a 0f407018 6010050a 15b11710 801c1de0 86018114 070aa803 a0609208 10c10a00 004888f0 0424a404 4085b040 0e00c816 09c42903 f1fe1141 021ea40c 1aaa0020 260a8104 00e02c18 00064201 50120040 bc148e30 33a00083 72168438 02042403 40001082 08808260 902000ad 0c000306 06864803 a0064000 25212a70 | 01030000 01407000 00100100 84010600 00040080 0023c010 00000000 20000008 00a00300 000208c0 00200000 4003b000 1e00801a 00092001 80001008 021a0008 00220000 02080400 02802890 01000201 00000020 38040e30 13000083 02500018 00000401 80002002 00800800 10200020 08000200 00060001 e0024000 00802200 |