On Target PA_INFA 0.25174826/CHEMBL2040554
For the given ligand Azithromycin, we have found in our database that, being scored 0.25174826, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Azithromycin (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CC[C@H]3OC(=O)[C@H](C)[C@@H](O[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]3(C)O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00010040 01000000 00100500 00010700 803c00c0 00200000 00002800 28000000 00200000 010000a0 00200000 40019000 1400802a 03880000 00080000 002a9008 10a20000 00000000 11c0a000 00000201 00100020 10000a10 07000080 08100010 00000401 00000000 00000200 34000020 00000200 0004000a 00e20000 00002a00 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |