On Target NA_INFB 0.5652174/CHEMBL183817
For the given ligand Azithromycin, we have found in our database that, being scored 0.5652174, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Azithromycin (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| CC[C@H]3OC(=O)[C@H](C)[C@@H](O[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)CN(C)[C@H](C)[C@@H](O)[C@]3(C)O | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010040 01000000 00100500 00010700 803c00c0 00200000 00002800 28000000 00200000 010000a0 00200000 40019000 1400802a 03880000 00080000 002a9008 10a20000 00000000 11c0a000 00000201 00100020 10000a10 07000080 08100010 00000401 00000000 00000200 34000020 00000200 0004000a 00e20000 00002a00 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |