On Target RT_HIV1 0.2820513/CHEMBL4228598
For the given ligand Test1, we have found in our database that, being scored 0.2820513, the most similar ligand is CHEMBL4228598. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL4228598 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | C=C(C)[C@@H]1CC[C@]2(CNCCCN)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 00000000 01000c00 00100302 40050600 00000000 00004000 80000080 20000402 00000900 001809c0 08300000 40018800 00028002 00200000 00000402 00080008 00000400 02000020 02012000 00000201 01000100 18020a30 00008020 00500014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 00002600 |