On Target NS5B_HCV1A 0.26984128/CHEMBL446360
For the given ligand Test1, we have found in our database that, being scored 0.26984128, the most similar ligand is CHEMBL446360. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL446360 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | N#Cc1ccc(Br)cc1Oc1ccccc1C(=O)CC(=O)C(=O)O |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 00054004 01008808 2000010a 00018200 00081020 00020002 06404000 00000201 04000904 00880840 0814000a 4000d040 04008012 00200000 01000001 00082008 00400000 02000000 00c02008 00020001 00400100 08020a00 01000400 00400414 00000800 c0000000 00120800 00200000 00000302 00064422 81020408 08400400 |