On Target NA_INFB 0.1978022/CHEMBL348066
For the given ligand Test1, we have found in our database that, being scored 0.1978022, the most similar ligand is CHEMBL348066. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL348066 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | CCCN(CCc1ccccc1)C(=O)[C@@H]1OC(C(=O)O)=C[C@H](N)[C@H]1NC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 00030000 89007600 00100101 80010701 00000081 000003c0 00080180 38800c04 01200080 801889e8 88200000 4003d200 8c028002 00480000 02081408 38099008 30200004 82000141 40c14010 00002205 00004020 382a0f80 17008000 8b70001c 00001400 80000c00 00c04000 90000121 0c004200 00060413 0c040000 00006600 |