On Target NP_HCoV-OC43 0.14545454/CHEMBL3233481
For the given ligand Test1, we have found in our database that, being scored 0.14545454, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Test1 (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CN(C)Cc2cc(O)cc(C(=O)c1ccc(O)cc1)c2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000000 46000808 20000101 00010600 00000001 00000000 12000000 03001000 00000000 00080c40 08200000 40008200 00008802 00000000 00000000 28080008 00000000 02000000 00000400 00020200 00000000 08028200 00000000 00460014 00000000 a0000000 08120000 c0000000 00000180 00060002 80040000 00000600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |