On Target NS3_HCV1B 0.38/CHEMBL3927196
For the given ligand Oseltamivir, we have found in our database that, being scored 0.38, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/C(OC(CC)CC)C(NC(C)=O)C(N)C1 | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |