On Target NS3_HCV1B 0.278169/CHEMBL1170417
For the given ligand Fedratinib, we have found in our database that, being scored 0.278169, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |