On Target PA_INFA 0.3112583/CHEMBL2040554
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3112583, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/C(OC(CC)CC)C(NC(C)=O)C(N)C1 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |