On Target NS5B_HCV1A 0.41284403/CHEMBL3644895
For the given ligand Glimepiride, we have found in our database that, being scored 0.41284403, the most similar ligand is CHEMBL3644895. Check out the elaboration below.
| Glimepiride (Given Ligand) | CHEMBL3644895 (Similar Ligand) |
|---|---|
| CC/C3=C(C)/CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)N[C@@H]1CC[C@@H](C)CC1)cc2)C3=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00000010 01809000 01100100 02b10e00 00000048 08000000 08000004 20003404 01000000 011828c0 08202000 e0019400 04009102 00010041 80200000 00000000 22002008 02000500 02412040 00006201 80022100 18250710 00008000 89500018 00010000 88000000 80400000 1000052c 04000400 20060003 0c0a0000 00012660 | 00010090 0dc03400 01300100 07b10f00 00080008 00018000 080a0404 a0003408 10800200 0052a9f8 00202410 e001b400 0e00f002 01042141 80e00400 001a8008 02826014 02082000 40610850 00007603 80002100 bc250e10 01002003 3a440038 02012000 8002100e 80000000 9020042c 08800600 a1060093 a4184022 01012270 |