On Target NS5B_HCV1B 0.22180451/CHEMBL3645202
For the given ligand Oseltamivir, we have found in our database that, being scored 0.22180451, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/C(OC(CC)CC)C(NC(C)=O)C(N)C1 | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |