On Target NA_INFB 0.3983051/CHEMBL254679
For the given ligand Paritaprevir, we have found in our database that, being scored 0.3983051, the most similar ligand is CHEMBL254679. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL254679 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | C=C[C@H](OC)[C@H](NC(C)=O)[C@@H]1N[C@@H](C(=O)O)C[C@H]1/C=C\C |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 00010000 09007000 00100100 04010500 00080080 00000010 00080000 20000408 10000000 00108088 00200000 4001b000 0602801a 01802001 80181400 00080008 10a04000 00000040 40c02010 00000201 00000000 30040e30 13008081 02100018 00000001 00000000 00c04000 90000001 0c000200 00040401 24024000 00002210 |