On Target PR_SARS 0.26373628/CHEMBL2441741
For the given ligand Paritaprevir, we have found in our database that, being scored 0.26373628, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Paritaprevir (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| Cc8cnc(C(=O)N[C@H]7CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]6C[C@@H](Oc4nc3ccccc3c5ccccc45)CN6C7=O)cn8 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 1405a082 0d807018 20104908 15310f12 841410c0 02118110 060ac000 2000340b 10010200 005188d8 012d2404 4101b000 0682c81a 09542003 b1da15c1 001ca10c 1a224000 02000142 40e12000 02024201 c0020040 bc178e38 33a0c083 b2140138 02340001 00000000 08c04200 9000000d 0c000204 80060c81 a4064000 85012a70 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |