On Target RT_HIV1 0.32142857/CHEMBL3683702
For the given ligand Fedratinib, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL3683702. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL3683702 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | COC(=O)N[C@H](C(=O)NCC(F)CC[C@@H](CO)N(CCC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 00000012 09803200 01100100 05b10600 00081090 0001a0c0 00000000 2100000c 00c40a00 804808c0 08302004 6001b000 0c008002 00c02001 80680040 001e0008 10022000 02080000 00402018 00006601 c0000100 38240e30 23100001 db700058 02000800 a0000006 00000020 5000006c 0c000680 2606000b a0004000 00012670 |