On Target NS5B_HCV1B 0.32388663/CHEMBL3645179
For the given ligand Fedratinib, we have found in our database that, being scored 0.32388663, the most similar ligand is CHEMBL3645179. Check out the elaboration below.
| Fedratinib (Given Ligand) | CHEMBL3645179 (Similar Ligand) |
|---|---|
| Cc3cnc(Nc2ccc(OCCN1CCCC1)cc2)nc3Nc4cccc(S(=O)(=O)NC(C)(C)C)c4 | CCN(c1cc2nn(-c3ccc(Nc4ccc(F)cc4)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 04002012 00800008 21100088 09b80612 02081288 00024010 0200a010 200008c8 00002100 000008c0 00302004 60009000 04800022 00000001 812a1941 000c020c 10042000 12004000 0840000a 50a26201 c0080002 1c042000 32804840 08400018 02040000 00000004 02040800 100110cd 00008608 20660804 43000000 000102e0 | 00004006 00805e08 20180902 43390e00 010c0000 00004052 02040010 0200140c 00102900 000908c0 09312024 40118800 80008c23 01401201 800a0040 000e200c 04268000 02000004 0860000a 00224201 c0100101 1c878e38 20800800 8360001c 02104080 c0000040 02270080 8000108d 0c488104 0046804b c4048080 a01147e0 |