On Target NS3_HCV1B 0.3231939/CHEMBL1170410
For the given ligand Repaglinide, we have found in our database that, being scored 0.3231939, the most similar ligand is CHEMBL1170410. Check out the elaboration below.
| Repaglinide (Given Ligand) | CHEMBL1170410 (Similar Ligand) |
|---|---|
| CCOc3cc(CC(=O)N[C@@H](CC(C)C)c1ccccc1N2CCCCC2)ccc3C(=O)O | C=CCCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 04004002 43801808 2010010a 40050600 20001000 80126040 03000000 22001800 00000980 200808c0 08300004 50019820 03808802 20200080 41020541 0008200a 00048000 03008002 08080008 00820201 c0100100 18268e20 20000000 8150001c 00000000 c0000000 00000800 90011080 04088300 00060003 e0046080 60002600 | 08012082 65c03008 20104108 15310600 00241023 00018080 96060080 22081408 00800284 105988c0 08202404 4003b000 0f00c802 00442001 c1420541 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |