On Target GP_EBOV 0.32019705/CHEMBL3125897
For the given ligand Acarbose, we have found in our database that, being scored 0.32019705, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Acarbose (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| C[C@H]2O[C@H](O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@H](C(O)CO)[C@H](O)[C@@H](O)C=O)O[C@@H]1CO)[C@H](O)[C@@H](O)[C@@H]2N[C@H]3/C=C(CO)\[C@@H](O)[C@H](O)[C@H]3O | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00050050 81008000 00101800 80810500 803800c0 00000000 00103800 28000442 00202000 011000a8 00200200 c001d000 1402812a 02810000 0028140c 002b9108 30800040 00000120 11c1a010 00002201 00100020 10000210 17008080 08100010 10001401 00008c00 00484200 b4000021 00000202 00040000 04a20000 02002a00 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |