On Target RT_HIV1 0.4117647/CHEMBL4227382
For the given ligand Repaglinide, we have found in our database that, being scored 0.4117647, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| Repaglinide (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| CCOc3cc(CC(=O)N[C@@H](CC(C)C)c1ccccc1N2CCCCC2)ccc3C(=O)O | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 04004002 43801808 2010010a 40050600 20001000 80126040 03000000 22001800 00000980 200808c0 08300004 50019820 03808802 20200080 41020541 0008200a 00048000 03008002 08080008 00820201 c0100100 18268e20 20000000 8150001c 00000000 c0000000 00000800 90011080 04088300 00060003 e0046080 60002600 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |