On Target NS5B_HCV1A 0.3604061/CHEMBL68034
For the given ligand Repaglinide, we have found in our database that, being scored 0.3604061, the most similar ligand is CHEMBL68034. Check out the elaboration below.
| Repaglinide (Given Ligand) | CHEMBL68034 (Similar Ligand) |
|---|---|
| CCOc3cc(CC(=O)N[C@@H](CC(C)C)c1ccccc1N2CCCCC2)ccc3C(=O)O | CC(C)COC(=O)N[C@H](C(=O)N1C[C@H](c2ccccc2)C[C@H]1C(=O)N[C@@H](CC(F)F)C(=O)NCCc1c(F)cc(C(=O)O)cc1F)C(C)C |
|
|
|
|
|
|
| 04004002 43801808 2010010a 40050600 20001000 80126040 03000000 22001800 00000980 200808c0 08300004 50019820 03808802 20200080 41020541 0008200a 00048000 03008002 08080008 00820201 c0100100 18268e20 20000000 8150001c 00000000 c0000000 00000800 90011080 04088300 00060003 e0046080 60002600 | 00010000 01403a00 00100102 46050600 00000400 0001c010 00000000 2004000c 00900b80 000928c0 08300000 d001b800 0e008012 00203101 80000000 001e0408 010a0200 02080000 00000810 00000201 00000100 38260e30 01002003 c350001c 00000000 80001082 00000060 90200021 0c000200 0406800b e0004000 00402600 |