On Target NS5B_HCV1A 0.28947368/CHEMBL363650
For the given ligand Rosiglitazone, we have found in our database that, being scored 0.28947368, the most similar ligand is CHEMBL363650. Check out the elaboration below.
| Rosiglitazone (Given Ligand) | CHEMBL363650 (Similar Ligand) |
|---|---|
| CN(CCOc2ccc(CC1SC(=O)NC1=O)cc2)c3ccccn3 | COc1ccc2c(O[C@H]3CC(C(=O)[C@@H](NC(=O)[C@@H](NC(C)=O)C4CCCCC4)C(C)C)[C@H](C(=O)CC4(C(=O)O)CC4)C3)ccnc2c1 |
|
|
|
|
|
|
| 04006002 00001328 20107308 00110606 00051080 00000800 02040000 00000000 00400800 230948c1 08340005 40009300 0481b802 000c0000 01001001 000c000c 04040410 02004200 08200008 00a20101 40120108 1c048604 32800900 02600018 00000800 80000020 08120080 140000c0 00008208 0006081b 00005010 83010600 | 04050002 01003008 20104008 04010700 000c1000 02000000 06000000 20000008 00000000 000008c0 00200004 4001b000 0680883a 01c02001 91000041 000c200c 00800000 00000104 02602000 00060a01 40000000 38048e18 21800001 82100018 00000000 00000000 00000000 10000000 08000202 01060001 20064000 00202200 |