On Target NSP15_SARS 0.18396227/CHEMBL2441745
For the given ligand Acarbose, we have found in our database that, being scored 0.18396227, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Acarbose (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| C[C@H]2O[C@H](O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@H](C(O)CO)[C@H](O)[C@@H](O)C=O)O[C@@H]1CO)[C@H](O)[C@@H](O)[C@@H]2N[C@H]3/C=C(CO)\[C@@H](O)[C@H](O)[C@H]3O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00050050 81008000 00101800 80810500 803800c0 00000000 00103800 28000442 00202000 011000a8 00200200 c001d000 1402812a 02810000 0028140c 002b9108 30800040 00000120 11c1a010 00002201 00100020 10000210 17008080 08100010 10001401 00008c00 00484200 b4000021 00000202 00040000 04a20000 02002a00 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |