On Target PLP_SARS 0.33014354/CHEMBL212080
For the given ligand Acarbose, we have found in our database that, being scored 0.33014354, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Acarbose (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| C[C@H]2O[C@H](O[C@H]1[C@H](O)[C@@H](O)[C@@H](O[C@H](C(O)CO)[C@H](O)[C@@H](O)C=O)O[C@@H]1CO)[C@H](O)[C@@H](O)[C@@H]2N[C@H]3/C=C(CO)\[C@@H](O)[C@H](O)[C@H]3O | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00050050 81008000 00101800 80810500 803800c0 00000000 00103800 28000442 00202000 011000a8 00200200 c001d000 1402812a 02810000 0028140c 002b9108 30800040 00000120 11c1a010 00002201 00100020 10000210 17008080 08100010 10001401 00008c00 00484200 b4000021 00000202 00040000 04a20000 02002a00 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |