On Target PLP_SARS 0.24/CHEMBL358279
For the given ligand Rosiglitazone, we have found in our database that, being scored 0.24, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Rosiglitazone (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| CN(CCOc2ccc(CC1SC(=O)NC1=O)cc2)c3ccccn3 | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 04006002 00001328 20107308 00110606 00051080 00000800 02040000 00000000 00400800 230948c1 08340005 40009300 0481b802 000c0000 01001001 000c000c 04040410 02004200 08200008 00a20101 40120108 1c048604 32800900 02600018 00000800 80000020 08120080 140000c0 00008208 0006081b 00005010 83010600 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |