On Target NSP1_SARS 0.24752475/CHEMBL2441741
For the given ligand Rosiglitazone, we have found in our database that, being scored 0.24752475, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Rosiglitazone (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| CN(CCOc2ccc(CC1SC(=O)NC1=O)cc2)c3ccccn3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 04006002 00001328 20107308 00110606 00051080 00000800 02040000 00000000 00400800 230948c1 08340005 40009300 0481b802 000c0000 01001001 000c000c 04040410 02004200 08200008 00a20101 40120108 1c048604 32800900 02600018 00000800 80000020 08120080 140000c0 00008208 0006081b 00005010 83010600 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |