On Target NS3_HCV1B 0.22147651/CHEMBL3927196
For the given ligand Flurandrenolide, we have found in our database that, being scored 0.22147651, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| Flurandrenolide (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| CC5(C)O[C@@H]4C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)CC[C@]1(C)[C@H]2[C@@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00010000 81000000 00100000 00010100 003c1440 00200004 00000880 08000402 01200000 01108020 00000000 4000d000 14028028 02800000 00000400 08281008 00800000 80000020 1341a000 00002001 00000020 00000280 05008000 08100014 00200400 00000000 00404020 b4000020 00000200 03000000 24a20000 00000200 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |