On Target NS3_HCV1B 0.23809524/CHEMBL3927196
For the given ligand Beclomethasone dipropionate, we have found in our database that, being scored 0.23809524, the most similar ligand is CHEMBL3927196. Check out the elaboration below.
| Beclomethasone dipropionate (Given Ligand) | CHEMBL3927196 (Similar Ligand) |
|---|---|
| CCC(=O)OCC(=O)[C@@]4(OC(=O)CC)[C@@H](C)C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\C1(C)[C@@]2(Cl)[C@@H](O)C[C@@]34C | CC(C)=CC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 000b0042 81000000 00000100 00090300 00380040 00000000 00000080 02000402 01000000 01100000 00000400 4000d000 04028028 00800000 00000400 08081008 00820000 80002000 13412000 00022001 00000021 90000b80 01008000 00000814 00200400 08000000 00404000 80000008 00800200 0100000a 24020000 02822800 | 00030000 01403400 00100000 04000600 00000000 00018010 00000000 20000408 05800200 00120180 00200000 5001b000 0e02801a 01002011 80000400 001a0008 00020000 00080001 00012810 00000201 00000000 300c0e70 00008003 02100018 00001000 00000002 00404000 90200020 08000200 00040011 a4024000 00802200 |