On Target PA_INFA 0.27218935/CHEMBL278402
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.27218935, the most similar ligand is CHEMBL278402. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL278402 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | O=C(O)C(=O)/C=C(\O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 00008000 01000000 00900902 00110600 00100000 00000000 000001c0 22001402 15100840 001808c2 08300200 5001d800 82028826 00200000 00000404 00080008 00004000 02000000 00450000 00000201 00000100 18008b80 01008040 00500010 00202000 c0000000 00440000 90000000 04004100 00060002 34040000 00030e00 |