On Target PA_INFA 0.26277372/CHEMBL2040554
For the given ligand Flurandrenolide, we have found in our database that, being scored 0.26277372, the most similar ligand is CHEMBL2040554. Check out the elaboration below.
| Flurandrenolide (Given Ligand) | CHEMBL2040554 (Similar Ligand) |
|---|---|
| CC5(C)O[C@@H]4C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)CC[C@]1(C)[C@H]2[C@@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(CC2CCCCC2)CC1 |
|
|
|
|
|
|
| 00010000 81000000 00100000 00010100 003c1440 00200004 00000880 08000402 01200000 01108020 00000000 4000d000 14028028 02800000 00000400 08281008 00800000 80000020 1341a000 00002001 00000020 00000280 05008000 08100014 00200400 00000000 00404020 b4000020 00000200 03000000 24a20000 00000200 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 28000400 01100800 001808c0 08300000 5001d800 86028026 00200000 00000400 00080008 00000000 02000000 02252018 00000201 00000100 18000b90 04008000 00500010 00003800 80002400 00444000 90000000 00004000 00060002 04020000 00822600 |