On Target GP_EBOV 0.34391534/CHEMBL3125897
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.34391534, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |