On Target PR_HIV1 0.20434782/CHEMBL449291
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.20434782, the most similar ligand is CHEMBL449291. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL449291 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCS(=O)(=O)CCOC2)cc1 |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 00000010 05c05409 2110050b 01b10600 000810c0 00028020 02000000 20000044 00542a00 014849e0 0830b000 60018010 00008002 80240001 81e80011 001a0008 14022000 02080000 01400800 01027603 80000120 18280c90 07100240 d9500058 02020400 8000001e 00800020 102020ec 04000600 22060013 80000000 04012670 |