On Target PR_HIV1 0.08988764/CHEMBL494500
For the given ligand Hydrocortisone, we have found in our database that, being scored 0.08988764, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Hydrocortisone (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CC14CCC(=O)/C=C1/CC[C@H]3[C@@H]2CC[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@H]34 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 00010000 81000000 00000000 00000000 00280000 00000000 00000080 00000402 01000000 00108000 00000000 40005000 04028028 00800000 00000400 00080008 00000000 00000020 03412000 00002001 00000000 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |