On Target PR_HIV1 0.1928934/CHEMBL494500
For the given ligand Beclomethasone dipropionate, we have found in our database that, being scored 0.1928934, the most similar ligand is CHEMBL494500. Check out the elaboration below.
| Beclomethasone dipropionate (Given Ligand) | CHEMBL494500 (Similar Ligand) |
|---|---|
| CCC(=O)OCC(=O)[C@@]4(OC(=O)CC)[C@@H](C)C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\C1(C)[C@@]2(Cl)[C@@H](O)C[C@@]34C | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CCCOCC2)cc1 |
|
|
|
|
|
|
| 000b0042 81000000 00000100 00090300 00380040 00000000 00000080 02000402 01000000 01100000 00000400 4000d000 04028028 00800000 00000400 08081008 00820000 80002000 13412000 00022001 00000021 90000b80 01008000 00000814 00200400 08000000 00404000 80000008 00800200 0100000a 24020000 02822800 | 00000050 01c05408 2110010a 01b10700 002810c0 00028000 02000000 a0000004 00540a00 014809e0 08342000 60018000 00008002 00a00101 81e80001 001a1008 10822000 02080000 11402800 01027603 80000120 18280c90 03100040 d9500058 02000400 8000100e 00800000 1020008c 04000600 2006001b 80000000 00012670 |