On Target RT_HIV1 0.38947368/CHEMBL404519
For the given ligand Flurandrenolide, we have found in our database that, being scored 0.38947368, the most similar ligand is CHEMBL404519. Check out the elaboration below.
| Flurandrenolide (Given Ligand) | CHEMBL404519 (Similar Ligand) |
|---|---|
| CC5(C)O[C@@H]4C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)CC[C@]1(C)[C@H]2[C@@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](OC(=O)CC(C)(C)C(=O)O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00010000 81000000 00100000 00010100 003c1440 00200004 00000880 08000402 01200000 01108020 00000000 4000d000 14028028 02800000 00000400 08281008 00800000 80000020 1341a000 00002001 00000020 00000280 05008000 08100014 00200400 00000000 00404020 b4000020 00000200 03000000 24a20000 00000200 | 00050040 01000000 00000100 00010300 00280000 00000000 00000000 00000400 00000000 00108008 00000000 40009000 04008008 00800000 00000400 00081008 00820000 00000100 12402000 00000001 00000020 00000a00 01000000 00000010 00000400 00000000 00000000 80000000 00000202 01000002 24020000 00000000 |