On Target NS5B_HCV1A 0.24193548/CHEMBL320324
For the given ligand Triamcinolone, we have found in our database that, being scored 0.24193548, the most similar ligand is CHEMBL320324. Check out the elaboration below.
| Triamcinolone (Given Ligand) | CHEMBL320324 (Similar Ligand) |
|---|---|
| CC14/C=C\C(=O)\C=C1\CC[C@H]3[C@@H]2C[C@@H](O)[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@]34F | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCC1)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000000 40005000 14028028 02800000 00000400 00080008 00000000 00000000 03412000 00022001 00000001 00000280 05008000 00520810 00200000 00000002 00404020 90000000 00000000 03000000 24020000 00000200 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e00800a 00002001 80000000 001a0408 000a0000 00080001 00c02810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 03040001 a0024000 00002200 |