On Target NS5B_HCV1A 0.24242425/CHEMBL320324
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.24242425, the most similar ligand is CHEMBL320324. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL320324 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCC1)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e00800a 00002001 80000000 001a0408 000a0000 00080001 00c02810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 03040001 a0024000 00002200 |