On Target NS5B_HCV1A 0.21276596/CHEMBL3659510
For the given ligand Hydrocortisone, we have found in our database that, being scored 0.21276596, the most similar ligand is CHEMBL3659510. Check out the elaboration below.
| Hydrocortisone (Given Ligand) | CHEMBL3659510 (Similar Ligand) |
|---|---|
| CC14CCC(=O)/C=C1/CC[C@H]3[C@@H]2CC[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@H]34 | CCC[C@H](NC(=O)[C@@H]1[C@H]2[C@H]3C=C[C@H](C3)[C@H]2CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1cnccn1)C1CCCCC1)C(C)(C)C)C(=O)C(=O)NC1CC1 |
|
|
|
|
|
|
| 00010000 81000000 00000000 00000000 00280000 00000000 00000080 00000402 01000000 00108000 00000000 40005000 04028028 00800000 00000400 00080008 00000000 00000020 03412000 00002001 00000000 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 | 10018002 01803400 00100800 14000c10 00000040 00100010 0000c000 2000340b 14000000 001181a0 01290000 40013000 0e02801a 01102001 80820400 00040104 08024000 02000023 02012010 00000201 80000000 300f8e30 2100c003 02100018 00341000 00200000 08404000 90000004 0c000004 01060811 a4024000 80002200 |