On Target NS5B_HCV1B 0.13414635/CHEMBL3645202
For the given ligand Triamcinolone, we have found in our database that, being scored 0.13414635, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Triamcinolone (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CC14/C=C\C(=O)\C=C1\CC[C@H]3[C@@H]2C[C@@H](O)[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@]34F | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000000 40005000 14028028 02800000 00000400 00080008 00000000 00000000 03412000 00022001 00000001 00000280 05008000 00520810 00200000 00000002 00404020 90000000 00000000 03000000 24020000 00000200 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |