On Target NS5B_HCV1B 0.18577075/CHEMBL3645202
For the given ligand Beclomethasone dipropionate, we have found in our database that, being scored 0.18577075, the most similar ligand is CHEMBL3645202. Check out the elaboration below.
| Beclomethasone dipropionate (Given Ligand) | CHEMBL3645202 (Similar Ligand) |
|---|---|
| CCC(=O)OCC(=O)[C@@]4(OC(=O)CC)[C@@H](C)C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\C1(C)[C@@]2(Cl)[C@@H](O)C[C@@]34C | CNC(=O)c1c2cc(C3CC3)c(N(CCCNC(=O)[C@H]3CCC[C@@H]3C(=O)OC)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 000b0042 81000000 00000100 00090300 00380040 00000000 00000080 02000402 01000000 01100000 00000400 4000d000 04028028 00800000 00000400 08081008 00820000 80002000 13412000 00022001 00000021 90000b80 01008000 00000814 00200400 08000000 00404000 80000008 00800200 0100000a 24020000 02822800 | 00074006 0180de08 20180902 41310f00 211c0000 00004042 02040000 22001408 00100900 004909e0 09312024 40119800 84008c3b 01c00201 808a0040 000e200e 04a68000 02000104 08602008 00225203 e0100101 1c8b8e38 2180c800 9370001c 02104080 c0000048 00270280 9000108c 0c488306 0146005b c4068088 a8916fe0 |