On Target NA_INFB 0.2857143/CHEMBL370047
For the given ligand Triamcinolone, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL370047. Check out the elaboration below.
| Triamcinolone (Given Ligand) | CHEMBL370047 (Similar Ligand) |
|---|---|
| CC14/C=C\C(=O)\C=C1\CC[C@H]3[C@@H]2C[C@@H](O)[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@]34F | C/C=C\[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000000 40005000 14028028 02800000 00000400 00080008 00000000 00000000 03412000 00022001 00000001 00000280 05008000 00520810 00200000 00000002 00404020 90000000 00000000 03000000 24020000 00000200 | 00010000 09003000 00100000 04000400 00080080 00000010 00080000 20000408 10000000 00108088 00200000 40013000 0602801a 01802001 80180400 00080008 10004000 00000040 00402000 00000201 00000000 30040e30 03008001 02100018 00000000 00000000 00404000 90000000 0c000000 00040401 24024000 00002200 |