On Target NA_INFB 0.2819149/CHEMBL309834
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.2819149, the most similar ligand is CHEMBL309834. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL309834 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | CCC(CC)O[C@@H]1C(F)=C(C(=O)O)C[C@H](N)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 000701c0 09007000 00100000 80010500 00180480 00000800 02080184 38000402 11000000 00100088 40200000 41019001 0402809a 01880000 00001408 00081408 1aa84000 00000060 60c12010 00000201 00000120 30040e80 13008000 62500118 10001400 00001400 00c04060 90000001 0c000200 06040401 04020000 00000610 |