On Target NA_INFB 0.3809524/CHEMBL183817
For the given ligand Flurandrenolide, we have found in our database that, being scored 0.3809524, the most similar ligand is CHEMBL183817. Check out the elaboration below.
| Flurandrenolide (Given Ligand) | CHEMBL183817 (Similar Ligand) |
|---|---|
| CC5(C)O[C@@H]4C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)CC[C@]1(C)[C@H]2[C@@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | COC(=O)[C@@H]1C[C@H](C(=O)O)O[C@H]1[C@H](CC(C)C)NC(C)=O |
|
|
|
|
|
|
| 00010000 81000000 00100000 00010100 003c1440 00200004 00000880 08000402 01200000 01108020 00000000 4000d000 14028028 02800000 00000400 08281008 00800000 80000020 1341a000 00002001 00000020 00000280 05008000 08100014 00200400 00000000 00404020 b4000020 00000200 03000000 24a20000 00000200 | 00070040 01005000 00100000 80010500 003c00c0 00200000 00000000 20000000 00000000 01020080 00200000 4001d000 1400802a 03800000 00081008 18099008 10820000 80000100 11402000 00000201 00000020 10040e10 17000000 0810001c 10000400 00000000 00800200 10000021 00000200 00040001 00020000 00800a00 |