On Target NSP15_SARS 0.3888889/CHEMBL1092796
For the given ligand Triamcinolone, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| Triamcinolone (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CC14/C=C\C(=O)\C=C1\CC[C@H]3[C@@H]2C[C@@H](O)[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@]34F | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000000 40005000 14028028 02800000 00000400 00080008 00000000 00000000 03412000 00022001 00000001 00000280 05008000 00520810 00200000 00000002 00404020 90000000 00000000 03000000 24020000 00000200 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |