On Target NP_HCoV-OC43 0.04918033/CHEMBL3233481
For the given ligand Triamcinolone, we have found in our database that, being scored 0.04918033, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Triamcinolone (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC14/C=C\C(=O)\C=C1\CC[C@H]3[C@@H]2C[C@@H](O)[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@]34F | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00010002 81400000 00100000 00081000 00281400 00000000 00000080 02000402 01000000 00100000 00000000 40005000 14028028 02800000 00000400 00080008 00000000 00000000 03412000 00022001 00000001 00000280 05008000 00520810 00200000 00000002 00404020 90000000 00000000 03000000 24020000 00000200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |