On Target NP_HCoV-OC43 0.07185629/CHEMBL3233481
For the given ligand Fluticasone propionate, we have found in our database that, being scored 0.07185629, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Fluticasone propionate (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@]4(C(=O)SCF)[C@H](C)C[C@H]3[C@@H]2C[C@H](F)/C1=C/C(=O)/C=C\C1(C)[C@@]2(F)[C@@H](O)C[C@@]34C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00010042 81400000 00100101 00191304 00281400 00000000 00000080 02000402 05a14000 00104001 00003001 4002d000 0403802a 80a40000 00000410 08081408 048a0000 80000000 12412000 00022001 00000021 00000a80 01808100 00720814 00200400 00000022 04404020 b0002000 00000200 13000002 24020000 87030200 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |