On Target NP_HCoV-OC43 0.028571429/CHEMBL3233481
For the given ligand Hydrocortisone, we have found in our database that, being scored 0.028571429, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Hydrocortisone (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC14CCC(=O)/C=C1/CC[C@H]3[C@@H]2CC[C@](O)(C(=O)CO)[C@@]2(C)C[C@H](O)[C@@H]34 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00010000 81000000 00000000 00000000 00280000 00000000 00000080 00000402 01000000 00108000 00000000 40005000 04028028 00800000 00000400 00080008 00000000 00000020 03412000 00002001 00000000 00000280 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |